C29H39N — CID 178169461
N-benzyl-N-methyl-3-propan-2-ylaniline;1,4-di(propan-2-yl)benzene (PubChem CID 178169461) has the molecular formula C29H39N and a molecular weight of 401.64 g/mol. Its IUPAC name is N-benzyl-N-methyl-3-propan-2-ylaniline;1,4-di(propan-2-yl)benzene.
| Compound Name | N-benzyl-N-methyl-3-propan-2-ylaniline;1,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 178169461 |
| Molecular Formula | C29H39N |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | N-benzyl-N-methyl-3-propan-2-ylaniline;1,4-di(propan-2-yl)benzene |
| SMILES | CC(C)c1ccc(C(C)C)cc1.CC(C)c1cccc(N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H21N.C12H18/c1-14(2)16-10-7-11-17(12-16)18(3)13-15-8-5-4-6-9-15;1-9(2)11-5-7-12(8-6-11)10(3)4/h4-12,14H,13H2,1-3H3;5-10H,1-4H3 |
| InChIKey | YJDOUANPVYBCAN-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |