C17H29N3O — CID 178170431
ethane;N-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]-3-pyrazol-1-ylbutanamide (PubChem CID 178170431) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is ethane;N-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]-3-pyrazol-1-ylbutanamide.
| Compound Name | ethane;N-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]-3-pyrazol-1-ylbutanamide |
|---|---|
| PubChem CID | 178170431 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | ethane;N-[(2E,4Z)-5-methylhepta-2,4-dien-2-yl]-3-pyrazol-1-ylbutanamide |
| SMILES | CC.CC/C(C)=C\C=C(/C)NC(=O)CC(C)n1cccn1 |
| InChI | InChI=1S/C15H23N3O.C2H6/c1-5-12(2)7-8-13(3)17-15(19)11-14(4)18-10-6-9-16-18;1-2/h6-10,14H,5,11H2,1-4H3,(H,17,19);1-2H3/b12-7-,13-8+; |
| InChIKey | PWUBXUAIZYBHKJ-LFMUNRFZSA-N |
| XLogP | 4.24 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|