C14H27NO3 — CID 178171740
ethane;(2E)-2-methyl-4-(oxetan-2-ylmethylamino)penta-2,4-dienoic acid (PubChem CID 178171740) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is ethane;(2E)-2-methyl-4-(oxetan-2-ylmethylamino)penta-2,4-dienoic acid.
| Compound Name | ethane;(2E)-2-methyl-4-(oxetan-2-ylmethylamino)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 178171740 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | ethane;(2E)-2-methyl-4-(oxetan-2-ylmethylamino)penta-2,4-dienoic acid |
| SMILES | C=C(/C=C(\C)C(=O)O)NCC1CCO1.CC.CC |
| InChI | InChI=1S/C10H15NO3.2C2H6/c1-7(10(12)13)5-8(2)11-6-9-3-4-14-9;2*1-2/h5,9,11H,2-4,6H2,1H3,(H,12,13);2*1-2H3/b7-5+;; |
| InChIKey | UBKYRYFKSYHYRE-WVKUUHRJSA-N |
| XLogP | 2.96 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|