C22H35N3O7 — CID 178172684
butane;1-[methyl(2-pyridin-2-ylethyl)carbamoyl]oxyethyl 2-[(2-acetyloxyacetyl)-methylamino]acetate (PubChem CID 178172684) has the molecular formula C22H35N3O7 and a molecular weight of 453.54 g/mol. Its IUPAC name is butane;1-[methyl(2-pyridin-2-ylethyl)carbamoyl]oxyethyl 2-[(2-acetyloxyacetyl)-methylamino]acetate.
| Compound Name | butane;1-[methyl(2-pyridin-2-ylethyl)carbamoyl]oxyethyl 2-[(2-acetyloxyacetyl)-methylamino]acetate |
|---|---|
| PubChem CID | 178172684 |
| Molecular Formula | C22H35N3O7 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | butane;1-[methyl(2-pyridin-2-ylethyl)carbamoyl]oxyethyl 2-[(2-acetyloxyacetyl)-methylamino]acetate |
| SMILES | CC(=O)OCC(=O)N(C)CC(=O)OC(C)OC(=O)N(C)CCc1ccccn1.CCCC |
| InChI | InChI=1S/C18H25N3O7.C4H10/c1-13(22)26-12-16(23)21(4)11-17(24)27-14(2)28-18(25)20(3)10-8-15-7-5-6-9-19-15;1-3-4-2/h5-7,9,14H,8,10-12H2,1-4H3;3-4H2,1-2H3 |
| InChIKey | RJYOTSRCWBWTJD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 115.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|