C12H23F2NO — CID 178173041
3,3-difluoro-6-propan-2-yl-1,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine;ethane (PubChem CID 178173041) has the molecular formula C12H23F2NO and a molecular weight of 235.32 g/mol. Its IUPAC name is 3,3-difluoro-6-propan-2-yl-1,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine;ethane.
| Compound Name | 3,3-difluoro-6-propan-2-yl-1,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine;ethane |
|---|---|
| PubChem CID | 178173041 |
| Molecular Formula | C12H23F2NO |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 3,3-difluoro-6-propan-2-yl-1,4,6,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazine;ethane |
| SMILES | CC.CC(C)C1CCC2COC(F)(F)CN21 |
| InChI | InChI=1S/C10H17F2NO.C2H6/c1-7(2)9-4-3-8-5-14-10(11,12)6-13(8)9;1-2/h7-9H,3-6H2,1-2H3;1-2H3 |
| InChIKey | VIPLTESDJKXBIC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |