C9H15F2NO — CID 130610139
(4aR,7aS)-1-(2,2-difluoroethyl)-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine (PubChem CID 130610139) has the molecular formula C9H15F2NO and a molecular weight of 191.22 g/mol. Its IUPAC name is (4aR,7aS)-1-(2,2-difluoroethyl)-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine.
| Compound Name | (4aR,7aS)-1-(2,2-difluoroethyl)-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine |
|---|---|
| PubChem CID | 130610139 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (4aR,7aS)-1-(2,2-difluoroethyl)-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine |
| SMILES | FC(F)CN1CCC[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C9H15F2NO/c10-9(11)4-12-3-1-2-7-5-13-6-8(7)12/h7-9H,1-6H2/t7-,8+/m0/s1 |
| InChIKey | VOGCQEKBRZPBDE-JGVFFNPUSA-N |
| XLogP | 1.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |