C9H16FNO — CID 130723850
(4aR,7aS)-1-(2-fluoroethyl)-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine (PubChem CID 130723850) has the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. Its IUPAC name is (4aR,7aS)-1-(2-fluoroethyl)-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine.
| Compound Name | (4aR,7aS)-1-(2-fluoroethyl)-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine |
|---|---|
| PubChem CID | 130723850 |
| Molecular Formula | C9H16FNO |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (4aR,7aS)-1-(2-fluoroethyl)-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine |
| SMILES | FCCN1CCC[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C9H16FNO/c10-3-5-11-4-1-2-8-6-12-7-9(8)11/h8-9H,1-7H2/t8-,9+/m0/s1 |
| InChIKey | JFWUAQPBGZOXNY-DTWKUNHWSA-N |
| XLogP | 1.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |