C17H13F3N4O2 — CID 178173674
4-methoxy-6-phenylmethoxy-2-pyrimidin-5-yl-5-(trifluoromethyl)pyrimidine (PubChem CID 178173674) has the molecular formula C17H13F3N4O2 and a molecular weight of 362.31 g/mol. Its IUPAC name is 4-methoxy-6-phenylmethoxy-2-pyrimidin-5-yl-5-(trifluoromethyl)pyrimidine.
| Compound Name | 4-methoxy-6-phenylmethoxy-2-pyrimidin-5-yl-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 178173674 |
| Molecular Formula | C17H13F3N4O2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 4-methoxy-6-phenylmethoxy-2-pyrimidin-5-yl-5-(trifluoromethyl)pyrimidine |
| SMILES | COc1nc(-c2cncnc2)nc(OCc2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C17H13F3N4O2/c1-25-15-13(17(18,19)20)16(26-9-11-5-3-2-4-6-11)24-14(23-15)12-7-21-10-22-8-12/h2-8,10H,9H2,1H3 |
| InChIKey | KUDZKWHFGGHCTI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |