C14H15F3N4O — CID 162358652
6-methoxy-N-propyl-2-pyridin-4-yl-5-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 162358652) has the molecular formula C14H15F3N4O and a molecular weight of 312.29 g/mol. Its IUPAC name is 6-methoxy-N-propyl-2-pyridin-4-yl-5-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 6-methoxy-N-propyl-2-pyridin-4-yl-5-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 162358652 |
| Molecular Formula | C14H15F3N4O |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 6-methoxy-N-propyl-2-pyridin-4-yl-5-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2ccncc2)nc(OC)c1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N4O/c1-3-6-19-12-10(14(15,16)17)13(22-2)21-11(20-12)9-4-7-18-8-5-9/h4-5,7-8H,3,6H2,1-2H3,(H,19,20,21) |
| InChIKey | ASZMSIKNABPYIN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |