C18H14F3N3OS — CID 162358723
4-methoxy-6-(4-methylphenyl)sulfanyl-2-pyridin-4-yl-5-(trifluoromethyl)pyrimidine (PubChem CID 162358723) has the molecular formula C18H14F3N3OS and a molecular weight of 377.39 g/mol. Its IUPAC name is 4-methoxy-6-(4-methylphenyl)sulfanyl-2-pyridin-4-yl-5-(trifluoromethyl)pyrimidine.
| Compound Name | 4-methoxy-6-(4-methylphenyl)sulfanyl-2-pyridin-4-yl-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 162358723 |
| Molecular Formula | C18H14F3N3OS |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-methoxy-6-(4-methylphenyl)sulfanyl-2-pyridin-4-yl-5-(trifluoromethyl)pyrimidine |
| SMILES | COc1nc(-c2ccncc2)nc(Sc2ccc(C)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C18H14F3N3OS/c1-11-3-5-13(6-4-11)26-17-14(18(19,20)21)16(25-2)23-15(24-17)12-7-9-22-10-8-12/h3-10H,1-2H3 |
| InChIKey | ZGDILEXUGILDMJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |