C7H16N2OS — CID 178176734
ethane;3-methyl-1,3-thiazolidine-4-carboxamide (PubChem CID 178176734) has the molecular formula C7H16N2OS and a molecular weight of 176.28 g/mol. Its IUPAC name is ethane;3-methyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | ethane;3-methyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 178176734 |
| Molecular Formula | C7H16N2OS |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | ethane;3-methyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CC.CN1CSCC1C(N)=O |
| InChI | InChI=1S/C5H10N2OS.C2H6/c1-7-3-9-2-4(7)5(6)8;1-2/h4H,2-3H2,1H3,(H2,6,8);1-2H3 |
| InChIKey | NYELJRJMVYABPD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |