C5H8N2O2S — CID 141184233
3-methyl-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 141184233) has the molecular formula C5H8N2O2S and a molecular weight of 160.20 g/mol. Its IUPAC name is 3-methyl-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-methyl-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 141184233 |
| Molecular Formula | C5H8N2O2S |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 3-methyl-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | CN1C(=O)SCC1C(N)=O |
| InChI | InChI=1S/C5H8N2O2S/c1-7-3(4(6)8)2-10-5(7)9/h3H,2H2,1H3,(H2,6,8) |
| InChIKey | BNJBGGBZEIAMRU-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|