C6H9NO3S — CID 71498111
3-ethyl-2-oxo-1,3-thiazolidine-4-carboxylic acid (PubChem CID 71498111) has the molecular formula C6H9NO3S and a molecular weight of 175.21 g/mol. Its IUPAC name is 3-ethyl-2-oxo-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-ethyl-2-oxo-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 71498111 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 3-ethyl-2-oxo-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCN1C(=O)SCC1C(=O)O |
| InChI | InChI=1S/C6H9NO3S/c1-2-7-4(5(8)9)3-11-6(7)10/h4H,2-3H2,1H3,(H,8,9) |
| InChIKey | FUBXUZGJYVZUNY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|