C10H17NO4 — CID 97052315
(2S,5R)-1,2-diethylpyrrolidine-2,5-dicarboxylic acid (PubChem CID 97052315) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is (2S,5R)-1,2-diethylpyrrolidine-2,5-dicarboxylic acid.
| Compound Name | (2S,5R)-1,2-diethylpyrrolidine-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 97052315 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (2S,5R)-1,2-diethylpyrrolidine-2,5-dicarboxylic acid |
| SMILES | CCN1[C@@H](C(=O)O)CC[C@@]1(CC)C(=O)O |
| InChI | InChI=1S/C10H17NO4/c1-3-10(9(14)15)6-5-7(8(12)13)11(10)4-2/h7H,3-6H2,1-2H3,(H,12,13)(H,14,15)/t7-,10+/m1/s1 |
| InChIKey | LWNCPHCIPYDOAN-XCBNKYQSSA-N |
| XLogP | 0.79 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |