C16H12F6 — CID 178176787
2,3-bis(ethenyl)-4,4-bis(trifluoromethyl)-1H-naphthalene (PubChem CID 178176787) has the molecular formula C16H12F6 and a molecular weight of 318.26 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4,4-bis(trifluoromethyl)-1H-naphthalene.
| Compound Name | 2,3-bis(ethenyl)-4,4-bis(trifluoromethyl)-1H-naphthalene |
|---|---|
| PubChem CID | 178176787 |
| Molecular Formula | C16H12F6 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2,3-bis(ethenyl)-4,4-bis(trifluoromethyl)-1H-naphthalene |
| SMILES | C=CC1=C(C=C)C(C(F)(F)F)(C(F)(F)F)c2ccccc2C1 |
| InChI | InChI=1S/C16H12F6/c1-3-10-9-11-7-5-6-8-13(11)14(12(10)4-2,15(17,18)19)16(20,21)22/h3-8H,1-2,9H2 |
| InChIKey | IYKPOAWXOQYZBP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |