ethane;N-ethenyl-2-methylidenebutanimidoyl chloride

C9H16ClN — CID 178177793

IUPACethane;N-ethenyl-2-methylidenebutanimidoyl chloride
SMILESC=C/N=C(\Cl)C(=C)CC.CC
InChIInChI=1S/C7H10ClN.C2H6/c1-4-6(3)7(8)9-5-2;1-2/h5H,2-4H2,1H3;1-2H3/b9-7-;
InChIKeyTYOMOAVUZVKKQV-VILQZVERSA-N
MW173.69 g/mol
LogP3.76
Rot. Bonds3

About ethane;N-ethenyl-2-methylidenebutanimidoyl chloride

ethane;N-ethenyl-2-methylidenebutanimidoyl chloride (PubChem CID 178177793) has the molecular formula C9H16ClN and a molecular weight of 173.69 g/mol. Its IUPAC name is ethane;N-ethenyl-2-methylidenebutanimidoyl chloride.

Molecular Properties

Compound Nameethane;N-ethenyl-2-methylidenebutanimidoyl chloride
PubChem CID178177793
Molecular FormulaC9H16ClN
Molecular Weight173.69 g/mol
Exact Mass173.10
IUPAC Nameethane;N-ethenyl-2-methylidenebutanimidoyl chloride
SMILESC=C/N=C(\Cl)C(=C)CC.CC
InChIInChI=1S/C7H10ClN.C2H6/c1-4-6(3)7(8)9-5-2;1-2/h5H,2-4H2,1H3;1-2H3/b9-7-;
InChIKeyTYOMOAVUZVKKQV-VILQZVERSA-N
XLogP3.76
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.69
LogP ≤ 53.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze ethane;N-ethenyl-2-methylidenebutanimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;N-ethenyl-2-methylidenebutanimidoyl chloride?
The IUPAC name of ethane;N-ethenyl-2-methylidenebutanimidoyl chloride (CID 178177793) is ethane;N-ethenyl-2-methylidenebutanimidoyl chloride.
What is the SMILES notation for ethane;N-ethenyl-2-methylidenebutanimidoyl chloride?
The canonical SMILES for ethane;N-ethenyl-2-methylidenebutanimidoyl chloride is C=C/N=C(\Cl)C(=C)CC.CC.
What is the InChIKey of ethane;N-ethenyl-2-methylidenebutanimidoyl chloride?
The InChIKey is TYOMOAVUZVKKQV-VILQZVERSA-N. The full InChI is InChI=1S/C7H10ClN.C2H6/c1-4-6(3)7(8)9-5-2;1-2/h5H,2-4H2,1H3;1-2H3/b9-7-;.
What are the key properties of ethane;N-ethenyl-2-methylidenebutanimidoyl chloride?
ethane;N-ethenyl-2-methylidenebutanimidoyl chloride has a molecular weight of 173.69 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethenyl-2-methylidenebutanimidoyl chloride is sourced from PubChem (CID 178177793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).