About ethane;N-ethenyl-2-methylidenebutanimidoyl chloride
ethane;N-ethenyl-2-methylidenebutanimidoyl chloride (PubChem CID 178177793) has the molecular formula C9H16ClN
and a molecular weight of 173.69 g/mol. Its IUPAC name is ethane;N-ethenyl-2-methylidenebutanimidoyl chloride.
Molecular Properties
| Compound Name | ethane;N-ethenyl-2-methylidenebutanimidoyl chloride |
| PubChem CID | 178177793 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | ethane;N-ethenyl-2-methylidenebutanimidoyl chloride |
| SMILES | C=C/N=C(\Cl)C(=C)CC.CC |
| InChI | InChI=1S/C7H10ClN.C2H6/c1-4-6(3)7(8)9-5-2;1-2/h5H,2-4H2,1H3;1-2H3/b9-7-; |
| InChIKey | TYOMOAVUZVKKQV-VILQZVERSA-N |
| XLogP | 3.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethenyl-2-methylidenebutanimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethenyl-2-methylidenebutanimidoyl chloride?
The IUPAC name of ethane;N-ethenyl-2-methylidenebutanimidoyl chloride (CID 178177793) is ethane;N-ethenyl-2-methylidenebutanimidoyl chloride.
What is the SMILES notation for ethane;N-ethenyl-2-methylidenebutanimidoyl chloride?
The canonical SMILES for ethane;N-ethenyl-2-methylidenebutanimidoyl chloride is C=C/N=C(\Cl)C(=C)CC.CC.
What is the InChIKey of ethane;N-ethenyl-2-methylidenebutanimidoyl chloride?
The InChIKey is TYOMOAVUZVKKQV-VILQZVERSA-N. The full InChI is InChI=1S/C7H10ClN.C2H6/c1-4-6(3)7(8)9-5-2;1-2/h5H,2-4H2,1H3;1-2H3/b9-7-;.
What are the key properties of ethane;N-ethenyl-2-methylidenebutanimidoyl chloride?
ethane;N-ethenyl-2-methylidenebutanimidoyl chloride has a molecular weight of 173.69 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethenyl-2-methylidenebutanimidoyl chloride is sourced from PubChem (CID 178177793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).