C11H11ClN2O3 — CID 178180699
8-chlorospiro[2H-imidazo[1,5-a]pyridine-3,4'-oxane]-1,5-dione (PubChem CID 178180699) has the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. Its IUPAC name is 8-chlorospiro[2H-imidazo[1,5-a]pyridine-3,4'-oxane]-1,5-dione.
| Compound Name | 8-chlorospiro[2H-imidazo[1,5-a]pyridine-3,4'-oxane]-1,5-dione |
|---|---|
| PubChem CID | 178180699 |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 8-chlorospiro[2H-imidazo[1,5-a]pyridine-3,4'-oxane]-1,5-dione |
| SMILES | O=C1NC2(CCOCC2)n2c1c(Cl)ccc2=O |
| InChI | InChI=1S/C11H11ClN2O3/c12-7-1-2-8(15)14-9(7)10(16)13-11(14)3-5-17-6-4-11/h1-2H,3-6H2,(H,13,16) |
| InChIKey | HZHHMPLJWREHDC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |