C20H23F3N4O — CID 178180924
2-[6-[(3aR,7aS)-6-methyl-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-1-yl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol (PubChem CID 178180924) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-[6-[(3aR,7aS)-6-methyl-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-1-yl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol.
| Compound Name | 2-[6-[(3aR,7aS)-6-methyl-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-1-yl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 178180924 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[6-[(3aR,7aS)-6-methyl-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-b]pyridin-1-yl]-4-methylpyridazin-3-yl]-5-(trifluoromethyl)phenol |
| SMILES | Cc1cc(N2CC[C@H]3NCC(C)C[C@@H]32)nnc1-c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C20H23F3N4O/c1-11-7-16-15(24-10-11)5-6-27(16)18-8-12(2)19(26-25-18)14-4-3-13(9-17(14)28)20(21,22)23/h3-4,8-9,11,15-16,24,28H,5-7,10H2,1-2H3/t11?,15-,16+/m1/s1 |
| InChIKey | VAEVASXMPYPLAO-ZNQYIGRYSA-N |
| XLogP | 3.75 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |