C8H10N4O4 — CID 178186978
2-hydroxy-N-(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)acetamide (PubChem CID 178186978) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-hydroxy-N-(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)acetamide.
| Compound Name | 2-hydroxy-N-(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)acetamide |
|---|---|
| PubChem CID | 178186978 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-hydroxy-N-(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)acetamide |
| SMILES | C/N=C1\NC(=O)N(C)C(=O)\C1=N/C(=O)CO |
| InChI | InChI=1S/C8H10N4O4/c1-9-6-5(10-4(14)3-13)7(15)12(2)8(16)11-6/h13H,3H2,1-2H3,(H,9,11,16)/b10-5- |
| InChIKey | NOGBRQFFAHTPBI-YHYXMXQVSA-N |
| XLogP | -1.84 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|