About 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one
7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one (PubChem CID 178188834) has the molecular formula C8H4ClFN2O
and a molecular weight of 198.58 g/mol. Its IUPAC name is 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one |
| PubChem CID | 178188834 |
| Molecular Formula | C8H4ClFN2O |
| Molecular Weight | 198.58 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one |
| SMILES | O=C1C=CC2C=NC(Cl)=C(F)C2=N1 |
| InChI | InChI=1S/C8H4ClFN2O/c9-8-6(10)7-4(3-11-8)1-2-5(13)12-7/h1-4H |
| InChIKey | IIDAPVNAOMIKII-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.58 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one?
The IUPAC name of 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one (CID 178188834) is 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one.
What is the SMILES notation for 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one?
The canonical SMILES for 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one is O=C1C=CC2C=NC(Cl)=C(F)C2=N1.
What is the InChIKey of 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one?
The InChIKey is IIDAPVNAOMIKII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClFN2O/c9-8-6(10)7-4(3-11-8)1-2-5(13)12-7/h1-4H.
What are the key properties of 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one?
7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one has a molecular weight of 198.58 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-8-fluoro-4aH-1,6-naphthyridin-2-one is sourced from PubChem (CID 178188834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).