About 7-fluoro-4aH-1,5-naphthyridin-2-one
7-fluoro-4aH-1,5-naphthyridin-2-one (PubChem CID 75247395) has the molecular formula C8H5FN2O
and a molecular weight of 164.14 g/mol. Its IUPAC name is 7-fluoro-4aH-1,5-naphthyridin-2-one.
Molecular Properties
| Compound Name | 7-fluoro-4aH-1,5-naphthyridin-2-one |
| PubChem CID | 75247395 |
| Molecular Formula | C8H5FN2O |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 7-fluoro-4aH-1,5-naphthyridin-2-one |
| SMILES | O=C1C=CC2N=CC(F)=CC2=N1 |
| InChI | InChI=1S/C8H5FN2O/c9-5-3-7-6(10-4-5)1-2-8(12)11-7/h1-4,6H |
| InChIKey | NSDSMGLBPCJSQI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-4aH-1,5-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4aH-1,5-naphthyridin-2-one?
The IUPAC name of 7-fluoro-4aH-1,5-naphthyridin-2-one (CID 75247395) is 7-fluoro-4aH-1,5-naphthyridin-2-one.
What is the SMILES notation for 7-fluoro-4aH-1,5-naphthyridin-2-one?
The canonical SMILES for 7-fluoro-4aH-1,5-naphthyridin-2-one is O=C1C=CC2N=CC(F)=CC2=N1.
What is the InChIKey of 7-fluoro-4aH-1,5-naphthyridin-2-one?
The InChIKey is NSDSMGLBPCJSQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FN2O/c9-5-3-7-6(10-4-5)1-2-8(12)11-7/h1-4,6H.
What are the key properties of 7-fluoro-4aH-1,5-naphthyridin-2-one?
7-fluoro-4aH-1,5-naphthyridin-2-one has a molecular weight of 164.14 g/mol, XLogP of 0.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4aH-1,5-naphthyridin-2-one is sourced from PubChem (CID 75247395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).