C9H18ClNO2 — CID 178190351
(1S,3R)-3-methoxy-7-oxaspiro[3.5]nonan-1-amine;hydrochloride (PubChem CID 178190351) has the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. Its IUPAC name is (1S,3R)-3-methoxy-7-oxaspiro[3.5]nonan-1-amine;hydrochloride.
| Compound Name | (1S,3R)-3-methoxy-7-oxaspiro[3.5]nonan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 178190351 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | (1S,3R)-3-methoxy-7-oxaspiro[3.5]nonan-1-amine;hydrochloride |
| SMILES | CO[C@@H]1C[C@H](N)C12CCOCC2.Cl |
| InChI | InChI=1S/C9H17NO2.ClH/c1-11-8-6-7(10)9(8)2-4-12-5-3-9;/h7-8H,2-6,10H2,1H3;1H/t7-,8+;/m0./s1 |
| InChIKey | IQJBDBJRNRIIRT-KZYPOYLOSA-N |
| XLogP | 0.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |