C9H18N2 — CID 178190989
(3R,4R)-4-(cyclobutylmethyl)pyrrolidin-3-amine (PubChem CID 178190989) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (3R,4R)-4-(cyclobutylmethyl)pyrrolidin-3-amine.
| Compound Name | (3R,4R)-4-(cyclobutylmethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 178190989 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (3R,4R)-4-(cyclobutylmethyl)pyrrolidin-3-amine |
| SMILES | N[C@H]1CNC[C@H]1CC1CCC1 |
| InChI | InChI=1S/C9H18N2/c10-9-6-11-5-8(9)4-7-2-1-3-7/h7-9,11H,1-6,10H2/t8-,9+/m1/s1 |
| InChIKey | SXXGCJNMNDHUSN-BDAKNGLRSA-N |
| XLogP | 0.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |