C9H15NO — CID 178194048
1-[(1S,3S)-3-aminocyclohexyl]prop-2-en-1-one (PubChem CID 178194048) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-[(1S,3S)-3-aminocyclohexyl]prop-2-en-1-one.
| Compound Name | 1-[(1S,3S)-3-aminocyclohexyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 178194048 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-[(1S,3S)-3-aminocyclohexyl]prop-2-en-1-one |
| SMILES | C=CC(=O)[C@H]1CCC[C@H](N)C1 |
| InChI | InChI=1S/C9H15NO/c1-2-9(11)7-4-3-5-8(10)6-7/h2,7-8H,1,3-6,10H2/t7-,8-/m0/s1 |
| InChIKey | POVIFOMMGKJTIV-YUMQZZPRSA-N |
| XLogP | 1.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|