C7H16N2O3 — CID 67563163
carbonic acid;cyclohexane-1,3-diamine (PubChem CID 67563163) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is carbonic acid;cyclohexane-1,3-diamine.
| Compound Name | carbonic acid;cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 67563163 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | carbonic acid;cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(N)C1.O=C(O)O |
| InChI | InChI=1S/C6H14N2.CH2O3/c7-5-2-1-3-6(8)4-5;2-1(3)4/h5-6H,1-4,7-8H2;(H2,2,3,4) |
| InChIKey | DZUWRKSRWQDMCA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |