C13H21NO3 — CID 178194767
(3R,4R)-1-acetyl-3-cyclopentylpiperidine-4-carboxylic acid (PubChem CID 178194767) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (3R,4R)-1-acetyl-3-cyclopentylpiperidine-4-carboxylic acid.
| Compound Name | (3R,4R)-1-acetyl-3-cyclopentylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 178194767 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (3R,4R)-1-acetyl-3-cyclopentylpiperidine-4-carboxylic acid |
| SMILES | CC(=O)N1CC[C@@H](C(=O)O)[C@@H](C2CCCC2)C1 |
| InChI | InChI=1S/C13H21NO3/c1-9(15)14-7-6-11(13(16)17)12(8-14)10-4-2-3-5-10/h10-12H,2-8H2,1H3,(H,16,17)/t11-,12-/m1/s1 |
| InChIKey | ZVCLFDQUUUXNBS-VXGBXAGGSA-N |
| XLogP | 1.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |