About cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine
cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine (PubChem CID 178199783) has the molecular formula C15H18N2
and a molecular weight of 226.32 g/mol. Its IUPAC name is cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine |
| PubChem CID | 178199783 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine |
| SMILES | Cc1ccc2cc([C@H]3[C@H](N)C3(C)C)ccc2n1 |
| InChI | InChI=1S/C15H18N2/c1-9-4-5-10-8-11(6-7-12(10)17-9)13-14(16)15(13,2)3/h4-8,13-14H,16H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | IIAYASKLZYWIFY-KBPBESRZSA-N |
| XLogP | 2.99 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine?
The IUPAC name of cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine (CID 178199783) is cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine.
What is the SMILES notation for cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine?
The canonical SMILES for cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine is Cc1ccc2cc([C@H]3[C@H](N)C3(C)C)ccc2n1.
What is the InChIKey of cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine?
The InChIKey is IIAYASKLZYWIFY-KBPBESRZSA-N. The full InChI is InChI=1S/C15H18N2/c1-9-4-5-10-8-11(6-7-12(10)17-9)13-14(16)15(13,2)3/h4-8,13-14H,16H2,1-3H3/t13-,14-/m0/s1.
What are the key properties of cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine?
cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine has a molecular weight of 226.32 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-2,2-dimethyl-3-(2-methylquinolin-6-yl)cyclopropan-1-amine is sourced from PubChem (CID 178199783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).