C13H17ClN6OS — CID 178201816
4-chloro-5-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-4H-pyridazin-3-one (PubChem CID 178201816) has the molecular formula C13H17ClN6OS and a molecular weight of 340.84 g/mol. Its IUPAC name is 4-chloro-5-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-4H-pyridazin-3-one.
| Compound Name | 4-chloro-5-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-4H-pyridazin-3-one |
|---|---|
| PubChem CID | 178201816 |
| Molecular Formula | C13H17ClN6OS |
| Molecular Weight | 340.84 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 4-chloro-5-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]-4H-pyridazin-3-one |
| SMILES | CC(C)c1nsc(N2CCN(C3=CN=NC(=O)C3Cl)CC2)n1 |
| InChI | InChI=1S/C13H17ClN6OS/c1-8(2)11-16-13(22-18-11)20-5-3-19(4-6-20)9-7-15-17-12(21)10(9)14/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | JVXFXNNQQSVRTN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|