About 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one
8-chloro-3-methyl-8H-1,7-naphthyridin-2-one (PubChem CID 178201966) has the molecular formula C9H7ClN2O
and a molecular weight of 194.62 g/mol. Its IUPAC name is 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one.
Molecular Properties
| Compound Name | 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one |
| PubChem CID | 178201966 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one |
| SMILES | CC1=CC2=CC=NC(Cl)C2=NC1=O |
| InChI | InChI=1S/C9H7ClN2O/c1-5-4-6-2-3-11-8(10)7(6)12-9(5)13/h2-4,8H,1H3 |
| InChIKey | KBQFGUFZEUPDQS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one?
The IUPAC name of 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one (CID 178201966) is 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one.
What is the SMILES notation for 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one?
The canonical SMILES for 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one is CC1=CC2=CC=NC(Cl)C2=NC1=O.
What is the InChIKey of 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one?
The InChIKey is KBQFGUFZEUPDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O/c1-5-4-6-2-3-11-8(10)7(6)12-9(5)13/h2-4,8H,1H3.
What are the key properties of 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one?
8-chloro-3-methyl-8H-1,7-naphthyridin-2-one has a molecular weight of 194.62 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-3-methyl-8H-1,7-naphthyridin-2-one is sourced from PubChem (CID 178201966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).