About 6-chloro-6H-1,7-naphthyridin-2-one
6-chloro-6H-1,7-naphthyridin-2-one (PubChem CID 73198778) has the molecular formula C8H5ClN2O
and a molecular weight of 180.59 g/mol. Its IUPAC name is 6-chloro-6H-1,7-naphthyridin-2-one.
Molecular Properties
| Compound Name | 6-chloro-6H-1,7-naphthyridin-2-one |
| PubChem CID | 73198778 |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 6-chloro-6H-1,7-naphthyridin-2-one |
| SMILES | O=C1C=CC2=CC(Cl)N=CC2=N1 |
| InChI | InChI=1S/C8H5ClN2O/c9-7-3-5-1-2-8(12)11-6(5)4-10-7/h1-4,7H |
| InChIKey | PVBPIUUPLXMKCF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-6H-1,7-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-6H-1,7-naphthyridin-2-one?
The IUPAC name of 6-chloro-6H-1,7-naphthyridin-2-one (CID 73198778) is 6-chloro-6H-1,7-naphthyridin-2-one.
What is the SMILES notation for 6-chloro-6H-1,7-naphthyridin-2-one?
The canonical SMILES for 6-chloro-6H-1,7-naphthyridin-2-one is O=C1C=CC2=CC(Cl)N=CC2=N1.
What is the InChIKey of 6-chloro-6H-1,7-naphthyridin-2-one?
The InChIKey is PVBPIUUPLXMKCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O/c9-7-3-5-1-2-8(12)11-6(5)4-10-7/h1-4,7H.
What are the key properties of 6-chloro-6H-1,7-naphthyridin-2-one?
6-chloro-6H-1,7-naphthyridin-2-one has a molecular weight of 180.59 g/mol, XLogP of 1.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-6H-1,7-naphthyridin-2-one is sourced from PubChem (CID 73198778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).