C15H17N5O2 — CID 178202265
5-(5-methylfuran-2-yl)-N-[(E)-pyridin-3-ylmethylideneamino]pyrazolidine-3-carboxamide (PubChem CID 178202265) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 5-(5-methylfuran-2-yl)-N-[(E)-pyridin-3-ylmethylideneamino]pyrazolidine-3-carboxamide.
| Compound Name | 5-(5-methylfuran-2-yl)-N-[(E)-pyridin-3-ylmethylideneamino]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 178202265 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 5-(5-methylfuran-2-yl)-N-[(E)-pyridin-3-ylmethylideneamino]pyrazolidine-3-carboxamide |
| SMILES | Cc1ccc(C2CC(C(=O)N/N=C/c3cccnc3)NN2)o1 |
| InChI | InChI=1S/C15H17N5O2/c1-10-4-5-14(22-10)12-7-13(19-18-12)15(21)20-17-9-11-3-2-6-16-8-11/h2-6,8-9,12-13,18-19H,7H2,1H3,(H,20,21)/b17-9+ |
| InChIKey | DCSVILDJZYXBCK-RQZCQDPDSA-N |
| XLogP | 1.04 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|