About 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride
7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride (PubChem CID 17838) has the molecular formula C15H16ClN3
and a molecular weight of 273.77 g/mol. Its IUPAC name is 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride.
Molecular Properties
| Compound Name | 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride |
| PubChem CID | 17838 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride |
| SMILES | C[NH+](C)C1=Nc2ccccc2-c2ccccc2N1.[Cl-] |
| InChI | InChI=1S/C15H15N3.ClH/c1-18(2)15-16-13-9-5-3-7-11(13)12-8-4-6-10-14(12)17-15;/h3-10H,1-2H3,(H,16,17);1H |
| InChIKey | BRBPXNLQWGGSOP-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 28.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride?
The IUPAC name of 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride (CID 17838) is 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride.
What is the SMILES notation for 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride?
The canonical SMILES for 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride is C[NH+](C)C1=Nc2ccccc2-c2ccccc2N1.[Cl-].
What is the InChIKey of 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride?
The InChIKey is BRBPXNLQWGGSOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3.ClH/c1-18(2)15-16-13-9-5-3-7-11(13)12-8-4-6-10-14(12)17-15;/h3-10H,1-2H3,(H,16,17);1H.
What are the key properties of 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride?
7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride has a molecular weight of 273.77 g/mol, XLogP of -1.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-benzo[d][1,3]benzodiazepin-6-yl(dimethyl)azanium chloride is sourced from PubChem (CID 17838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).