About methyl 3-chlorobenzoate
methyl 3-chlorobenzoate (PubChem CID 17946) has the molecular formula C8H7ClO2
and a molecular weight of 170.59 g/mol. Its IUPAC name is methyl 3-chlorobenzoate.
Molecular Properties
| Compound Name | methyl 3-chlorobenzoate |
| PubChem CID | 17946 |
| Molecular Formula | C8H7ClO2 |
| Molecular Weight | 170.59 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | methyl 3-chlorobenzoate |
| SMILES | COC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H7ClO2/c1-11-8(10)6-3-2-4-7(9)5-6/h2-5H,1H3 |
| InChIKey | XRDRKVPNHIWTBX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.59 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chlorobenzoate?
The IUPAC name of methyl 3-chlorobenzoate (CID 17946) is methyl 3-chlorobenzoate.
What is the SMILES notation for methyl 3-chlorobenzoate?
The canonical SMILES for methyl 3-chlorobenzoate is COC(=O)c1cccc(Cl)c1.
What is the InChIKey of methyl 3-chlorobenzoate?
The InChIKey is XRDRKVPNHIWTBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO2/c1-11-8(10)6-3-2-4-7(9)5-6/h2-5H,1H3.
What are the key properties of methyl 3-chlorobenzoate?
methyl 3-chlorobenzoate has a molecular weight of 170.59 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chlorobenzoate is sourced from PubChem (CID 17946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).