About (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate
(Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate (PubChem CID 18003156) has the molecular formula C5H13O5Y+2
and a molecular weight of 242.06 g/mol. Its IUPAC name is (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate.
Molecular Properties
| Compound Name | (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate |
| PubChem CID | 18003156 |
| Molecular Formula | C5H13O5Y+2 |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate |
| SMILES | CC(=O)/C=C(/C)[O-].O.O.O.[Y+3] |
| InChI | InChI=1S/C5H8O2.3H2O.Y/c1-4(6)3-5(2)7;;;;/h3,6H,1-2H3;3*1H2;/q;;;;+3/p-1/b4-3-;;;; |
| InChIKey | COEXKBDROGUMTC-PHSMJEINSA-M |
| XLogP | -2.64 |
| TPSA | 134.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate?
The IUPAC name of (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate (CID 18003156) is (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate.
What is the SMILES notation for (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate?
The canonical SMILES for (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate is CC(=O)/C=C(/C)[O-].O.O.O.[Y+3].
What is the InChIKey of (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate?
The InChIKey is COEXKBDROGUMTC-PHSMJEINSA-M. The full InChI is InChI=1S/C5H8O2.3H2O.Y/c1-4(6)3-5(2)7;;;;/h3,6H,1-2H3;3*1H2;/q;;;;+3/p-1/b4-3-;;;;.
What are the key properties of (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate?
(Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate has a molecular weight of 242.06 g/mol, XLogP of -2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-oxopent-2-en-2-olate;yttrium(3+);trihydrate is sourced from PubChem (CID 18003156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).