C14H20Cl2N5- — CID 18003913
5-amino-2-[3-(3-methyl-2H-imidazol-1-yl)propylamino]benzonitrile;chloride;hydrochloride (PubChem CID 18003913) has the molecular formula C14H20Cl2N5- and a molecular weight of 329.26 g/mol. Its IUPAC name is 5-amino-2-[3-(3-methyl-2H-imidazol-1-yl)propylamino]benzonitrile;chloride;hydrochloride.
| Compound Name | 5-amino-2-[3-(3-methyl-2H-imidazol-1-yl)propylamino]benzonitrile;chloride;hydrochloride |
|---|---|
| PubChem CID | 18003913 |
| Molecular Formula | C14H20Cl2N5- |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-amino-2-[3-(3-methyl-2H-imidazol-1-yl)propylamino]benzonitrile;chloride;hydrochloride |
| SMILES | CN1C=CN(CCCNc2ccc(N)cc2C#N)C1.Cl.[Cl-] |
| InChI | InChI=1S/C14H19N5.2ClH/c1-18-7-8-19(11-18)6-2-5-17-14-4-3-13(16)9-12(14)10-15;;/h3-4,7-9,17H,2,5-6,11,16H2,1H3;2*1H/p-1 |
| InChIKey | QPVANFMLYKYUHI-UHFFFAOYSA-M |
| XLogP | -0.96 |
| TPSA | 68.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|