C12H8ClF3N4S — CID 18005349
5-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-methylsulfanylpyrazole-3-carbonitrile (PubChem CID 18005349) has the molecular formula C12H8ClF3N4S and a molecular weight of 332.74 g/mol. Its IUPAC name is 5-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-methylsulfanylpyrazole-3-carbonitrile.
| Compound Name | 5-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-methylsulfanylpyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 18005349 |
| Molecular Formula | C12H8ClF3N4S |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 5-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-methylsulfanylpyrazole-3-carbonitrile |
| SMILES | CSc1c(C#N)nn(-c2ccc(C(F)(F)F)cc2Cl)c1N |
| InChI | InChI=1S/C12H8ClF3N4S/c1-21-10-8(5-17)19-20(11(10)18)9-3-2-6(4-7(9)13)12(14,15)16/h2-4H,18H2,1H3 |
| InChIKey | OYFNHRSGJVXFON-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |