C17H8Cl2F3N5O2S — CID 66552982
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(4-nitrophenyl)sulfanylpyrazole-3-carbonitrile (PubChem CID 66552982) has the molecular formula C17H8Cl2F3N5O2S and a molecular weight of 474.25 g/mol. Its IUPAC name is 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(4-nitrophenyl)sulfanylpyrazole-3-carbonitrile.
| Compound Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(4-nitrophenyl)sulfanylpyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 66552982 |
| Molecular Formula | C17H8Cl2F3N5O2S |
| Molecular Weight | 474.25 g/mol |
| Exact Mass | 472.97 |
| IUPAC Name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(4-nitrophenyl)sulfanylpyrazole-3-carbonitrile |
| SMILES | N#Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H8Cl2F3N5O2S/c18-11-5-8(17(20,21)22)6-12(19)14(11)26-16(24)15(13(7-23)25-26)30-10-3-1-9(2-4-10)27(28)29/h1-6H,24H2 |
| InChIKey | NZKJBPSNQOPRRA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.25 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|