C38H36N2O6 — CID 18007930
N-[2-[7-[4-[8-[2-(furan-2-carbonylamino)ethyl]naphthalen-2-yl]oxybutoxy]naphthalen-1-yl]ethyl]furan-2-carboxamide (PubChem CID 18007930) has the molecular formula C38H36N2O6 and a molecular weight of 616.71 g/mol. Its IUPAC name is N-[2-[7-[4-[8-[2-(furan-2-carbonylamino)ethyl]naphthalen-2-yl]oxybutoxy]naphthalen-1-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[7-[4-[8-[2-(furan-2-carbonylamino)ethyl]naphthalen-2-yl]oxybutoxy]naphthalen-1-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18007930 |
| Molecular Formula | C38H36N2O6 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | N-[2-[7-[4-[8-[2-(furan-2-carbonylamino)ethyl]naphthalen-2-yl]oxybutoxy]naphthalen-1-yl]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCc1cccc2ccc(OCCCCOc3ccc4cccc(CCNC(=O)c5ccco5)c4c3)cc12)c1ccco1 |
| InChI | InChI=1S/C38H36N2O6/c41-37(35-11-5-23-45-35)39-19-17-29-9-3-7-27-13-15-31(25-33(27)29)43-21-1-2-22-44-32-16-14-28-8-4-10-30(34(28)26-32)18-20-40-38(42)36-12-6-24-46-36/h3-16,23-26H,1-2,17-22H2,(H,39,41)(H,40,42) |
| InChIKey | YFHIGHYANADMSA-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|