C28H29N3O5 — CID 18010036
tert-butyl N-[1-[ethynyl-[1-(3-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 18010036) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is tert-butyl N-[1-[ethynyl-[1-(3-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[ethynyl-[1-(3-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18010036 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | tert-butyl N-[1-[ethynyl-[1-(3-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C#CN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1cccc(O)c1 |
| InChI | InChI=1S/C28H29N3O5/c1-6-31(26(34)18(2)29-27(35)36-28(3,4)5)24(21-12-9-13-23(32)17-21)25(33)30-22-15-14-19-10-7-8-11-20(19)16-22/h1,7-18,24,32H,2-5H3,(H,29,35)(H,30,33) |
| InChIKey | ULJXGFWXJPWZRJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|