C23H37N3O4 — CID 18015297
tert-butyl N-[2-[[1-(2,3-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-methylamino]-2-oxoethyl]carbamate (PubChem CID 18015297) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(2,3-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-methylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(2,3-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18015297 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | tert-butyl N-[2-[[1-(2,3-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-methylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCNC(=O)C(c1cccc(C)c1C)N(C)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37N3O4/c1-8-9-10-14-24-21(28)20(18-13-11-12-16(2)17(18)3)26(7)19(27)15-25-22(29)30-23(4,5)6/h11-13,20H,8-10,14-15H2,1-7H3,(H,24,28)(H,25,29) |
| InChIKey | TUGBMFAMGVQLBD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|