C25H41N3O4 — CID 18019015
tert-butyl N-[2-[butan-2-yl-[2-(butylamino)-1-(3,4-dimethylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 18019015) has the molecular formula C25H41N3O4 and a molecular weight of 447.62 g/mol. Its IUPAC name is tert-butyl N-[2-[butan-2-yl-[2-(butylamino)-1-(3,4-dimethylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[butan-2-yl-[2-(butylamino)-1-(3,4-dimethylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18019015 |
| Molecular Formula | C25H41N3O4 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.31 |
| IUPAC Name | tert-butyl N-[2-[butan-2-yl-[2-(butylamino)-1-(3,4-dimethylphenyl)-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CCCCNC(=O)C(c1ccc(C)c(C)c1)N(C(=O)CNC(=O)OC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C25H41N3O4/c1-9-11-14-26-23(30)22(20-13-12-17(3)18(4)15-20)28(19(5)10-2)21(29)16-27-24(31)32-25(6,7)8/h12-13,15,19,22H,9-11,14,16H2,1-8H3,(H,26,30)(H,27,31) |
| InChIKey | QHRHSBCWVGQZTD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|