C29H47N3O4 — CID 18020067
tert-butyl N-[2-[[1-(3-ethenylphenyl)-2-oxo-2-(pentylamino)ethyl]-(5-methylhexan-2-yl)amino]-2-oxoethyl]carbamate (PubChem CID 18020067) has the molecular formula C29H47N3O4 and a molecular weight of 501.71 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(3-ethenylphenyl)-2-oxo-2-(pentylamino)ethyl]-(5-methylhexan-2-yl)amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(3-ethenylphenyl)-2-oxo-2-(pentylamino)ethyl]-(5-methylhexan-2-yl)amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18020067 |
| Molecular Formula | C29H47N3O4 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.36 |
| IUPAC Name | tert-butyl N-[2-[[1-(3-ethenylphenyl)-2-oxo-2-(pentylamino)ethyl]-(5-methylhexan-2-yl)amino]-2-oxoethyl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)NCCCCC)N(C(=O)CNC(=O)OC(C)(C)C)C(C)CCC(C)C)c1 |
| InChI | InChI=1S/C29H47N3O4/c1-9-11-12-18-30-27(34)26(24-15-13-14-23(10-2)19-24)32(22(5)17-16-21(3)4)25(33)20-31-28(35)36-29(6,7)8/h10,13-15,19,21-22,26H,2,9,11-12,16-18,20H2,1,3-8H3,(H,30,34)(H,31,35) |
| InChIKey | LMQNAGPICLPYEK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|