C27H43N3O4 — CID 18013227
tert-butyl N-[1-[butan-2-yl-[1-(3-ethenylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 18013227) has the molecular formula C27H43N3O4 and a molecular weight of 473.66 g/mol. Its IUPAC name is tert-butyl N-[1-[butan-2-yl-[1-(3-ethenylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[butan-2-yl-[1-(3-ethenylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18013227 |
| Molecular Formula | C27H43N3O4 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | tert-butyl N-[1-[butan-2-yl-[1-(3-ethenylphenyl)-2-oxo-2-(pentylamino)ethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)NCCCCC)N(C(=O)C(C)NC(=O)OC(C)(C)C)C(C)CC)c1 |
| InChI | InChI=1S/C27H43N3O4/c1-9-12-13-17-28-24(31)23(22-16-14-15-21(11-3)18-22)30(19(4)10-2)25(32)20(5)29-26(33)34-27(6,7)8/h11,14-16,18-20,23H,3,9-10,12-13,17H2,1-2,4-8H3,(H,28,31)(H,29,33) |
| InChIKey | DYIRRGWCCDKTEA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|