C25H39N3O4S — CID 18057400
tert-butyl N-[1-[[2-(butylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-propan-2-ylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18057400) has the molecular formula C25H39N3O4S and a molecular weight of 477.67 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-propan-2-ylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-propan-2-ylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18057400 |
| Molecular Formula | C25H39N3O4S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-propan-2-ylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)NCCCC)N(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C)C)c1 |
| InChI | InChI=1S/C25H39N3O4S/c1-8-10-14-26-22(29)21(19-13-11-12-18(9-2)15-19)28(17(3)4)23(30)20(16-33)27-24(31)32-25(5,6)7/h9,11-13,15,17,20-21,33H,2,8,10,14,16H2,1,3-7H3,(H,26,29)(H,27,31) |
| InChIKey | BTZFXMSVWKVQEJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|