C26H33N3O6 — CID 18021472
methyl 2-[[2-[ethynyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-(4-ethynylphenyl)acetyl]amino]acetate (PubChem CID 18021472) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is methyl 2-[[2-[ethynyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-(4-ethynylphenyl)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[ethynyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-(4-ethynylphenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 18021472 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | methyl 2-[[2-[ethynyl-[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-(4-ethynylphenyl)acetyl]amino]acetate |
| SMILES | C#Cc1ccc(C(C(=O)NCC(=O)OC)N(C#C)C(=O)C(NC(=O)OC(C)(C)C)C(C)CC)cc1 |
| InChI | InChI=1S/C26H33N3O6/c1-9-17(4)21(28-25(33)35-26(5,6)7)24(32)29(11-3)22(23(31)27-16-20(30)34-8)19-14-12-18(10-2)13-15-19/h2-3,12-15,17,21-22H,9,16H2,1,4-8H3,(H,27,31)(H,28,33) |
| InChIKey | JDNCKJRYIKZQON-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|