C24H33N3O7 — CID 18044257
methyl 2-[[2-[ethynyl-[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]acetate (PubChem CID 18044257) has the molecular formula C24H33N3O7 and a molecular weight of 475.54 g/mol. Its IUPAC name is methyl 2-[[2-[ethynyl-[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[ethynyl-[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 18044257 |
| Molecular Formula | C24H33N3O7 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | methyl 2-[[2-[ethynyl-[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]acetate |
| SMILES | C#CN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)NCC(=O)OC)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H33N3O7/c1-8-27(22(31)18(13-15(2)3)26-23(32)34-24(4,5)6)20(16-9-11-17(28)12-10-16)21(30)25-14-19(29)33-7/h1,9-12,15,18,20,28H,13-14H2,2-7H3,(H,25,30)(H,26,32) |
| InChIKey | RRCIKKRWISNRFQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|