C34H51N3O4 — CID 18025589
tert-butyl N-[1-[[2-(benzylamino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-hexylamino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18025589) has the molecular formula C34H51N3O4 and a molecular weight of 565.80 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(benzylamino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-hexylamino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(benzylamino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-hexylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18025589 |
| Molecular Formula | C34H51N3O4 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.39 |
| IUPAC Name | tert-butyl N-[1-[[2-(benzylamino)-1-(2,6-dimethylphenyl)-2-oxoethyl]-hexylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(NC(=O)OC(C)(C)C)C(C)CC)C(C(=O)NCc1ccccc1)c1c(C)cccc1C |
| InChI | InChI=1S/C34H51N3O4/c1-9-11-12-16-22-37(32(39)29(24(3)10-2)36-33(40)41-34(6,7)8)30(28-25(4)18-17-19-26(28)5)31(38)35-23-27-20-14-13-15-21-27/h13-15,17-21,24,29-30H,9-12,16,22-23H2,1-8H3,(H,35,38)(H,36,40) |
| InChIKey | MWMYXUBLEVORSK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|