C33H49N3O5 — CID 18025994
tert-butyl N-[1-[[2-(benzylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-heptylamino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18025994) has the molecular formula C33H49N3O5 and a molecular weight of 567.77 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(benzylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-heptylamino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(benzylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-heptylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18025994 |
| Molecular Formula | C33H49N3O5 |
| Molecular Weight | 567.77 g/mol |
| Exact Mass | 567.37 |
| IUPAC Name | tert-butyl N-[1-[[2-(benzylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-heptylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(NC(=O)OC(C)(C)C)C(C)CC)C(C(=O)NCc1ccccc1)c1cccc(O)c1 |
| InChI | InChI=1S/C33H49N3O5/c1-7-9-10-11-15-21-36(31(39)28(24(3)8-2)35-32(40)41-33(4,5)6)29(26-19-16-20-27(37)22-26)30(38)34-23-25-17-13-12-14-18-25/h12-14,16-20,22,24,28-29,37H,7-11,15,21,23H2,1-6H3,(H,34,38)(H,35,40) |
| InChIKey | FZOPJPRVRMFURP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.77 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|