C29H45N3O4S — CID 18030865
tert-butyl N-[1-[[2-(butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-(2-methylbutan-2-yl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18030865) has the molecular formula C29H45N3O4S and a molecular weight of 531.76 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-(2-methylbutan-2-yl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-(2-methylbutan-2-yl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18030865 |
| Molecular Formula | C29H45N3O4S |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | tert-butyl N-[1-[[2-(butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-(2-methylbutan-2-yl)amino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)NCCCC)N(C(=O)C(CCSC)NC(=O)OC(C)(C)C)C(C)(C)CC)cc1 |
| InChI | InChI=1S/C29H45N3O4S/c1-10-13-19-30-25(33)24(22-16-14-21(11-2)15-17-22)32(29(7,8)12-3)26(34)23(18-20-37-9)31-27(35)36-28(4,5)6/h2,14-17,23-24H,10,12-13,18-20H2,1,3-9H3,(H,30,33)(H,31,35) |
| InChIKey | MWJCTMUJLJMNTL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|