C26H39N3O4S — CID 18058225
tert-butyl N-[1-[tert-butyl-[2-(butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18058225) has the molecular formula C26H39N3O4S and a molecular weight of 489.68 g/mol. Its IUPAC name is tert-butyl N-[1-[tert-butyl-[2-(butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[tert-butyl-[2-(butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18058225 |
| Molecular Formula | C26H39N3O4S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | tert-butyl N-[1-[tert-butyl-[2-(butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]amino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)NCCCC)N(C(=O)C(CS)NC(=O)OC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H39N3O4S/c1-9-11-16-27-22(30)21(19-14-12-18(10-2)13-15-19)29(25(3,4)5)23(31)20(17-34)28-24(32)33-26(6,7)8/h2,12-15,20-21,34H,9,11,16-17H2,1,3-8H3,(H,27,30)(H,28,32) |
| InChIKey | IWLPILCRXRKQGW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|